Hướng dẫn Hỗ trợ: 098 1821 807 (8h30 - 21h)

GIỚI THIỆU BÀI HỌC

NỘI DUNG BÀI HỌC

Câu 1: Chất hữu cơ X chứa một loại nhóm chức, có công thức phân tử là C8H14O4. Khi thuỷ phân X trong NaOH thu được một muối và 2 rượu Y, Z. Số nguyên tử cacbon trong phân tử rượu Y gấp đôi số nguyên tử cacbon trong phân tử rượu Z. Khi đun nóng với H2SO4 đặc, Y cho ba olefin đồng phân còn Z chỉ cho một olefin duy nhất. Công thức cấu tạo phù hợp của X là:

      A. CH3OOCCH2COOCH2CH2CH2CH3.                B. CH3CH2OOCCOOCH2CH2CH2CH3.

      C. CH3CH2OOCCOOCH(CH3)CH2CH3.                D. CH3CH2COOCOOCH(CH3)CH2CH3.

Giải:

X: C8H14O4

X + NaOH → 1 muối + 2 ancol

\Delta =\frac{2x+2-y}{2}= 2 \ lk \ \pi

\begin{matrix} Axit \ \ \ \ Ancol \\ \left [ \begin{matrix} CO|O - C_{2}H_{5} \\ CO|O-C_{4}H_{9} \end{matrix} \right. \end{matrix}

\begin{matrix}C_{2}H_{5}-OOC-COO-C_{4}H_{9} \Leftrightarrow CH_{3}-CH_{2}-OOC-COO-CH-CH_{2}-CH_{3} \\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ ^| \\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ CH_{3} \end{matrix}

Loại A, D

\\ C_{2}H_{5}OH \rightarrow C_{2}H_{4}+H_{2}O \\ \\ C_{4}H_{9}OH \rightarrow 3 \ anken

⇒ Chọn C

Câu 2: Hỗn hợp X gồm: HCHO, CH3COOH, HCOOCH3 và CH3CH(OH)COOH. Đốt cháy hoàn toàn hỗn hợp X cần V lít O2 (đktc), sau phản ứng thu được CO2 và H2O. Hấp thụ hết sản phẩm cháy vào bình đựng nước vôi trong dư, thấy khối lượng bình tăng 15,5 gam. Vậy giá trị của V tương ứng là:

      A. 8,40 lít.                      B. 5,60 lít.                         C. 3,92 lít.                         D. 4,20 lít.

Giải:

X \left\{\begin{matrix} HCHO: CH_{2}O \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \\ \ \\ CH_{3}COOH:C_{2}H_{4}O_{2} \Leftrightarrow 2(CH_{2}O) \ \ \ \ \ \ \ \ \ \ \ \ \ \ \\ \ \\ HCOOCH_{3}:C_{2}H_{4}O_{2} \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \\ \ \\ \begin{matrix} CH_{3}-CH-COOH \\ ^| \ \ \ \\ OH \ \ \ \end{matrix} \begin{matrix} :C_{3}H_{6}O_{3} \Leftrightarrow 3(CH_{2}O) \\ \ \\ \ \end{matrix} \end{matrix}\right.

\\ CH_{2}O + O_{2}\rightarrow CO_{2} + H_{2}O \\ a \ \ \ \ \ \ \ a \ \ \ \ \ \ \rightarrow \ \ \ a \ \ \ \ \ \ \ a \\ \\ 15,5 = 44a + 18a \\ \\ \Rightarrow a = 0,25 \ mol \\ \\ V_{O_{2}} = 0,25.22,4 = 5,6 \ lit

⇒ Chọn B

Câu 3: Hỗn hợp X gồm C2H5OH; HCHO; CH3COOH; HCOOCH3; CH3COOC2H5; CH2OHCH(OH)CHO; CH3CH(OH)COOH. Đốt cháy hoàn toàn 19,4g hỗn hợp X cần vừa đủ 32g oxi, sau phản ứng thu được 0,9 mol H2O. Tính % theo khối lượng của CH3COOC2H5 trong hỗn hợp X?

      A. 45,36%                      B. 43,05%                         C. 46,62%                         D. 52,13%

Giải:

X\left\{\begin{matrix} C_{2}H_{5}OH: C_{2}H_{6}O \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \\ \ \\ HCHO: CH_{2}O \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \\ \ \\ CH_{3}COOH: C_{2}H_{3}O_{2} \ \ \ \ \ \ \ \ \ \ \ \ \ \\ \ \\ HCOOCH_{3}: C_{2}H_{4}O_{2} \ \ \ \ \ \ \ \ \ \ \ \ \\ \ \\ CH_{3}COOC_{2}H_{5} : C_{4}H_{8}O_{2} \ \ \ \ \ \ \ \ \\ \ \\ \begin{matrix} CH_{2}-CH-CHO \\ ^| \ \ \ \ \ \ \ \ \ ^| \ \ \ \ \ \ \ \ \ \ \\ OH \ \ \ \ \ OH \ \ \ \ \ \ \ \ \ \ \end{matrix} \begin{matrix} \ : C_{3}H_{6}O_{3} \\ \ \\ \ \end{matrix} \\ \ \\ \begin{matrix} CH_{3}-CH-COOH \\ ^| \ \ \ \\ OH \ \ \ \end{matrix} \begin{matrix} \ : C_{3}H_{6}O_{3} \\ \ \\ \ \end{matrix} \end{matrix}\right.

X \left\{\begin{matrix} C_{2}H_{6}O: a \ mol \\ \ \\ CH_{2}O: b \ mol \ \ \\ \ \\ C_{4}H_{8}O_{2} : c \ mol \end{matrix}\right.

\\ X + O_{2} \rightarrow CO_{2} + H_{2}O \\ \\ 19,4 = 46a + 30b + 88c \ \ (1) \\ \\ m_{X} + m_{O_{2}} = m_{CO_{2}} + m_{H_{2}O} \\ \\ m_{CO_{2}} = 19,4 + 32 - 0,9 .18 = 35,2 \ (g) \\ \\ n_{CO_{2}} = \frac{35,2}{44} = 0,8 \ mol \\ \\ n_{CO_{2}} = 0,8 = 2a+b+4c \ \ (2)

Bảo toàn nguyên tố oxy:

\\ a + b + 2c + 1.2 = 0,8.2 + 0,9 \ \ (3) \\ \\ 1, \ 2, \ 3 \Rightarrow \left\{\begin{matrix} a = 0,2 \\ b = 0,1 \\ c = 0,1 \end{matrix}\right. \Rightarrow \%m = \frac{88.0,1}{19,4}.100 \ \% = 45,36 \ \%

⇒ Chọn A

Câu 4: Đốt cháy hoàn toàn 17 gam hỗn hợp X gồm 1 ancol đơn chức và 1 este no, đơn chức, mạch hở thu được 12,32 lít CO2 (đktc) và 14,4 gam H2O. Mặt khác, nếu đun 17 gam hỗn hợp X với 150 ml dung dịch KOH 0,8M, rồi cô cạn dung dịch sau phản ứng thì khối lượng chất rắn khan thu được là:

      A. 8,16 gam.                  B. 9,96 gam.                      C. 10,08 gam.                   D. 11,88 gam.

Giải:

  • Este no, đơn mạch hở: CnH2nO2 (a mol)
  • Ancol đơn mạch hở: CmH2m+2O (b mol)

\\ n_{CO_{2}} = \frac{12,32}{22,4} = 0,55 \ mol \\ \\ n_{H_{2}O} = \frac{14,4}{18} = 0,8 \ mol

⇒ Ancol no, đơn mạch hở

\\ n_{ancol} = b = 0,8 - 0,55 = 0,25 \ mol \\ \\ m_{X} + m_{O_{2}} = m_{CO_{2}} + m_{H_{2}O} \\ \\ BTKL: \ 17 + m_{O_{2}} = 0,55.44 + 14,4 \\ \\ m_{O_{2}} = 21,6 \ gam \Rightarrow n_{O_{2}} = 0,675 \ mol

Bảo toàn nguyên tố oxy:

2a + b + 0,675 .2 = 0,55.2 + 0,8 ⇒ a = 0,15

\\ n_{CO_{2}} = 0,55 = na + mb \\ \\ \Leftrightarrow 0,55 = 0,15n + 0,25m

Tác dụng KOH este phản ứng

\\ HCOOCH_{3} + KOH \rightarrow HCOOK + CH_{3}OH \\ 0,15 \ \ \ \ \ \ \ > \ \ \ \ 0,12 \ \ \rightarrow \ \ \ 0,12 \\ \\ n_{KOH} = 0,15.0,8 = 0,12 \\ \\ m_{Cr} = 0,12 (45 + 39) = 8,16 \ gam

⇒ Chọn A

Câu 5: Đốt cháy hoàn toàn m gam chất béo X (chứa triglixerit của axit stearic, axit panmitic và các axit béo tự do đó). Sau phản ứng thu được 20,16 lít CO2 (đktc) và 15,66 gam nước. Xà phòng hóa m gam X (H = 90%) thì thu được khối lượng glixerol là:

      A. 2,760 gam.                B. 1,242 gam.                    C. 1,380 gam.                   D. 2,484 gam. 

Giải:

\\ \begin{matrix} R_{1}-COO-CH_{2} \\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ ^| \\ R_{1}-COO-CH \\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ ^| \\ R_{2}-COO-CH_{2} \end{matrix}; \ R_{1}COOH; \ R_{2}COOH \\ \\ R_{1}-COOH: C_{17}H_{35}COOH \\ \\ R_{2}-COOH: C_{15}H_{31}COOH

⇒ Chất béo no, axit no, đơn

\\ n_{CO_{2}} = \frac{20,16}{22,4} = 0,9 \ mol \\ \\ n_{H_{2}O} = \frac{15,66}{18} = 0,87 \ mol

CTPT chất béo: CnH2n+2-3.2O6 (a mol)

CTPT axit béo: CmH2mO2 (b mol)

CnH2n-4O6 → nCO2 + (n - 2) H2O
      a       →       na        na - 2a

CmH2mO2 → mCO2 + mH2O
      b                mb         mb

\\ n_{CO_{2}} - n_{H_{2}O} = na-mb-na+2a-mb = 2a \\ \\ 0,9-0,87=2a \Rightarrow a = 0,015 \ mol

Chất béo + 3NaOH → Muối + C3H5(OH)3
   0,015              →                 0,015

axit + NaOH → Muối + H2O

m_{glixerol} = 0,015.\frac{90}{100}.92 = 1,242 \ gam

⇒ Chọn B

Câu 6: Đốt cháy hoàn toàn m gam một chất béo (triglixerit) cần 1,61 mol O2, sinh ra 1,14 mol CO2 và 1,06 mol H2O. Cũng m gam chất béo này tác dụng vừa đủ với dung dịch NaOH thì khối lượng muối tạo thành là:

      A. 18,28 gam.                B. 16,68 gam.                    C. 20,28 gam.                   D. 23 gam.

Giải:

\\ CT: C_{x}H_{y}O_{6} \ (a \ mol) \\ \\ m_{cbeo} + m_{O_{2}} = m_{CO_{2}} + m_{H{2}O} \\ \\ m_{cbeo} = 1,14.44+1,06.18-1,61.32 = 17,72 \ gam

Chất béo + 3NaOH → Muối + 3C3H5(OH)3
  0,02     →   0,06         ?           0,02

Bao toàn nguyên tố oxy: 6a + 1,61.2 = 1,14.2+1,06

⇒ a = 0,02 mol

mmuối = 17,72 + 0,06.40 - 0,02.92 = 18,28 gam

Câu 7: Thuỷ phân hoàn toàn 444 gam một lipit thu được 46 gam glixerol (glixerin) và hai loại axit béo. Hai loại axit béo đó là

      A. C15H31COOH và C17H35COOH.                        B. C17H33COOH và C15H31COOH.

      C. C17H31COOH và C17H33COOH.                        D. C17H33COOH và C17H35COOH.

Giải:

\\ \begin{matrix} R_{1}-COO-CH_{2} \\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ ^| \\ R_{1}-COO-CH \\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ ^| \\ R_{2}-COO-CH_{2} \end{matrix} \ + \ 3H_{2}O\rightleftharpoons 2R_{1}COOH + R_{2}COOH + C_{3}H_{5}(OH)_{3}

      444 gam                                                                                                     46 gam
      0,5 mol                              1,5                   1                        0,5    \overset{ \ }{\leftarrow}           0,5 mol                              

\\ m_{2 \ axit} = 444 + 1,5.18 - 46 = 425 \ gam \\ \\ \overline{M}_{2 \ axit } = \frac{425}{1,5} = 283,33 \\ \\ M_{1} < 283,33 < M_{C_{17}H_{35}COOH} = 284

Nếu R1COOH(C17H35COOH): 1 mol

\\ \Rightarrow M_{R_{2}COOH} = \frac{425 - 284 }{0,5} = 282 \ (C_{17}H_{33}COOH) \\ \\ C_{17}H_{33}COOH; \ C_{17}H_{35}COOH \\ \\ R_{2}COOH (C_{17}H_{35}COOH) \Rightarrow M_{R_{1}COOH}= \frac{425-0,5.284}{1}=283 \ (loai)

⇒ Chọn D

Câu 8: Khi thủy phân một triglixerit X, thu được các axit béo gồm axit oleic, axit panmitic, axit stearic. Thể tích khí O2 (đktc) cần để đốt cháy hoàn toàn 8,6 gam X là:

      A. 16,128 lít.                  B. 20,160 lít.                     C. 17,472 lít.                     D. 15,680 lít.

Giải:

\\ \begin{matrix} C_{17}H_{33}COO-CH_{2} \\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ ^| \\ C_{15}H_{31}COO-CH \\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ ^| \\ C_{17}H_{35}COO-CH_{2} \end{matrix} \\ \\ CTPT: C_{55}H_{104}O_{6} \\ \\ C_{55}H_{104}O_{6} + 78O_{2} \rightarrow 55CO_{2} + 52 H_{2}O \\ 0,01 \ \ \rightarrow \ \ \ \ \ 0,78 \\ \\ n_{X} = \frac{8,6}{860} = 0,01 \ mol \\ \\ V_{O_{2}} = 0,78.22,4 = 17,472 \ lit

⇒ Chọn C

Câu 9: Cho 0,1 mol este E phản ứng vừa đủ với dung dịch chức 0,2 mol NaOH, cho ra hỗn hợp 2 muối natri có công thức C2H3O2Na và C3H3O2Na và 6,2 gam ancol X. E có công thức là:

      A. C6H10O4.                   B. C6H8O4.                        C. C7H10O4.                      D. C7H12O4.

Giải:

\\ E + NaOH \rightarrow C_{2}H_{3}O_{2}Na + C_{3}H_{3}O_{2}Na + ancol \ X \\ 0,1 \ \ 0,2 \ mol

\frac{n_{NaOH _{pu}}}{n_{E} } =2 (Có 2 (-COO-))

\\ M_{X} = \frac{6,2}{0,1} = 62 = R + 34 \Rightarrow R = 28 \ (-C_{2}H_{4}-) \\ \\ X: HO-CH_{2}-CH_{2}-OH \\ \\ \begin{matrix} \ \ \ \ \ \ \ \ \ \ CH_{3}-COO - CH_{2} \\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ ^| \\ CH_{2}=CH-COO-CH_{2} \end{matrix} \Leftrightarrow CH_{3}COOCH_{2}CH_{2}OOC-CH=CH_{2}

                                                                   \\ \\ C_{7}H_{10}O_{4}

⇒ Chọn C

Giảm 40% học phí 700.000đ 420.000đ

NỘI DUNG KHÓA HỌC

Chuyên đề 2: Este - Lipit

 Giáo viên: Thầy Hồ Sĩ Thạnh
6
00:53:48 Bài 1: Lí thuyết Este
Hỏi đáp
20 Bài tập
7
01:06:55 Bài 2: Bài tập Este - Phần 1
Hỏi đáp
20 Bài tập
8
01:00:59 Bài 3: Bài tập Este - Phần 2
Hỏi đáp
20 Bài tập
9
01:00:11 Bài 4: Bài tập Este - Phần 3
Hỏi đáp
20 Bài tập
10
00:58:02 Bài 5: Bài tập Este - Phần 4
Hỏi đáp
20 Bài tập
11
00:59:27 Bài 6: Bài tập Este - Phần 5
Hỏi đáp
20 Bài tập
12
01:13:04 Bài 7: Bài tập Este - Phần 6
Hỏi đáp
10 Bài tập
13
00:42:53 Bài 8: Lý thuyết và Bài tập Lipit
Hỏi đáp
20 Bài tập
14
00:32:44 Bài 9: Bài tập chất béo
Hỏi đáp
10 Bài tập

Chuyên đề 3: Cacbohydrat

 Giáo viên: Thầy Hồ Sĩ Thạnh
16
00:23:05 Bài 1: Lí thuyết Cacbohydrat
Hỏi đáp
10 Bài tập
17
00:34:12 Bài 2: Bài tập Cacbohydrat
Hỏi đáp
10 Bài tập
18
Kiểm tra: Đề thi online chuyên đề Cacbohydrat
0 Hỏi đáp
30 phút
20 Câu hỏi

Chuyên đề 4: Amin - Amino axit - Protein

 Giáo viên: Thầy Hồ Sĩ Thạnh
19
00:26:41 Bài 1: Lí thuyết Amin
Hỏi đáp
10 Bài tập
20
00:30:22 Bài 2: Bài tập Amin - Phần 1
Hỏi đáp
10 Bài tập
21
00:24:47 Bài 3: Bài tập Amin - Phần 2
Hỏi đáp
10 Bài tập
22
00:44:01 Bài 4: Bài tập Amin - Phần 3
Hỏi đáp
10 Bài tập
23
Kiểm tra: Đề thi online phần Amin
0 Hỏi đáp
45 phút
20 Câu hỏi
24
00:37:03 Bài 5: Lí thuyết Amino axit
Hỏi đáp
10 Bài tập
25
00:35:27 Bài 6: Bài tập Amino axit - Phần 1
Hỏi đáp
10 Bài tập
26
00:33:15 Bài 7: Bài tập Amino axit - Phần 2
Hỏi đáp
10 Bài tập
27
Kiểm tra: Đề thi online phần Amino axit
0 Hỏi đáp
45 phút
20 Câu hỏi
28
00:37:56 Bài 8: Bài tập tổng hợp Amin - Amino axit
Hỏi đáp
10 Bài tập
29
00:31:40 Bài 9: Lí thuyết Peptit - Protein
Hỏi đáp
10 Bài tập
30
00:24:04 Bài 10: Bài tập Peptit - Protein - Phần 1
Hỏi đáp
10 Bài tập
31
00:29:53 Bài 11: Bài tập Peptit - Protein - Phần 2
Hỏi đáp
10 Bài tập
32
00:30:20 Bài 12: Bài tập Peptit - Protein - Phần 3
Hỏi đáp
10 Bài tập
33
00:48:04 Bài 13: Bài tập Peptit - Protein - Phần 4
Hỏi đáp
10 Bài tập
34
Kiểm tra: Đề thi online phần Peptit - Protein
0 Hỏi đáp
30 phút
20 Câu hỏi
35
Đề thi online chuyên đề Amin - Amino axit - Protein
0 Hỏi đáp
30 phút
20 Câu hỏi

Chuyên đề 5: Polyme

 Giáo viên: Thầy Hồ Sĩ Thạnh
36
01:12:22 Bài 1: Lí thuyết Polyme
Hỏi đáp
10 Bài tập
37
00:33:30 Bài 2: Bài tập Polyme - Phần 1
Hỏi đáp
10 Bài tập
38
00:46:06 Bài 3: Bài tập Polyme - Phần 2
Hỏi đáp
10 Bài tập
39
Kiểm tra: Đề thi online chuyên đề Polyme
0 Hỏi đáp
30 phút
20 Câu hỏi

Chuyên đề 6: Đại cương kim loại

 Giáo viên: Thầy Hồ Sĩ Thạnh
40
00:24:33 Bài 1: Vị trí kim loại trong hệ thống tuần hoàn và tính chất vật lý Biết vị trí kim loại trong bảng HTTH, hiểu tính chất vật lý chung của kim loại.
Hỏi đáp
20 Bài tập
41
00:35:31 Bài 2: Hóa tính kim loại. Kim loại tác dụng với phi kim, dung dịch HCl, dung dịch H2SO4 (loãng) Biết tính chất hóa học chung của kim loại là tính khử.
Hỏi đáp
10 Bài tập
42
00:40:54 Bài 3: Kim loại tác dụng dung dịch HNO3, dung dịch H2SO4 đặc, nóng Biết sản phẩm khử,và vận dụng giải bài tập kim loại tác dụng dung dịch HNO3, dung dịch H2SO4 đặc, nóng.
Hỏi đáp
10 Bài tập
43
00:44:48 Bài 4: Kim loại tác dụng dung dịch muối và dãy điện hóa Biết dãy điện hóa kim loại, hiểu và vận dụng quy tắc anpha.
Hỏi đáp
10 Bài tập
44
00:31:38 Bài 5: Phản ứng với H+, NO3- Hiểu và vận dụng giải bài tập theo phương trình ion rút gọn.
Hỏi đáp
10 Bài tập
45
00:25:30 Bài 6: Kim loại tác dụng H2O Biết các kim loại tác dụng được với H2O,vận dụng khi các kl này tác dụng với dung dịch Muối.
Hỏi đáp
20 Bài tập
46
01:30:36 Bài 7: Sự điện phân kim loại (3 tiết) Biết điện phân là gì,các trường hợp điện phân,các quá trình xảy ra ở điện cực, áp dụng định luật Faraday.
Hỏi đáp
18 Bài tập
47
00:38:19 Bài 8: Ăn mòn và điều chế kim loại Biết cơ chế ăn mòn và biện pháp bảo vệ kim loại.Các phương pháp điều chế kim loại.
Hỏi đáp
10 Bài tập
49
00:33:45 Bài 1: Kim loại kiềm và hợp chất của chúng Biết cấu tạo-lý tính- hóa tính cua IA,IIA,Al
Hỏi đáp
10 Bài tập
50
00:34:37 Bài 2: Kim loại kiềm thổ Xác định muối tạo thành khi cho CO2 tác dụng bazơ.
Hỏi đáp
10 Bài tập
51
00:22:58 Bài 3: Phản ứng của CO2 với dung dịch Bazơ Ôn tập, củng cố kiến thức.
Hỏi đáp
10 Bài tập
52
00:41:39 Bài 4: Phản ứng của H+ với CO32-, HCO3-, nước cứng Nhận diện bài tập, xác định muối tạo thành hoặc khí CO2 bay ra.
Hỏi đáp
10 Bài tập
53
00:32:18 Bài 5: Hóa tính của Nhôm Nắm rõ hóa tính của Al, va hợp chất cua Al.
Hỏi đáp
10 Bài tập
54
00:37:24 Bài 6: Phản ứng nhiệt Nhôm Hiểu và vận dụng giải bài tập phản ứng nhiệt nhôm.
Hỏi đáp
12 Bài tập
55
00:30:20 Bài 7: Hợp chất của Nhôm Phân biệt dạng phản ứng của kim loại kiềm, Al với H2O và dung dịch bazơ.
Hỏi đáp
10 Bài tập
58
00:33:40 Bài 1: Crom và hợp chất của Crom Biết tính chất lý,hóa của Crôm
Hỏi đáp
59
00:29:18 Bài 2: Các bài tập quan trọng của Crom Biết tính chất của các hợp chất quan trọng của Crôm.
Hỏi đáp
60
00:43:45 Bài 3: Sắt
Hỏi đáp
61
00:30:23 Bài 4: Hợp chất của Sắt
Hỏi đáp
64
00:26:06 Bài 7: Bạc
Hỏi đáp
65